C17H31N7O7 — CID 18742736
2-[[2-[[1-(2-amino-3-hydroxypropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18742736) has the molecular formula C17H31N7O7 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-[[2-[[1-(2-amino-3-hydroxypropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[1-(2-amino-3-hydroxypropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18742736 |
| Molecular Formula | C17H31N7O7 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-[[2-[[1-(2-amino-3-hydroxypropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCCN1C(=O)C(N)CO)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C17H31N7O7/c18-9(7-25)15(29)24-6-2-4-12(24)14(28)22-10(3-1-5-21-17(19)20)13(27)23-11(8-26)16(30)31/h9-12,25-26H,1-8,18H2,(H,22,28)(H,23,27)(H,30,31)(H4,19,20,21) |
| InChIKey | NZJHWFJZYBFELS-UHFFFAOYSA-N |
| XLogP | -4.60 |
| TPSA | 246.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|