C19H34N8O6S — CID 18260098
5-amino-2-[[2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 18260098) has the molecular formula C19H34N8O6S and a molecular weight of 502.60 g/mol. Its IUPAC name is 5-amino-2-[[2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18260098 |
| Molecular Formula | C19H34N8O6S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 5-amino-2-[[2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C19H34N8O6S/c20-10(9-34)17(31)27-8-2-4-13(27)16(30)25-11(3-1-7-24-19(22)23)15(29)26-12(18(32)33)5-6-14(21)28/h10-13,34H,1-9,20H2,(H2,21,28)(H,25,30)(H,26,29)(H,32,33)(H4,22,23,24) |
| InChIKey | KUDJKTKJMVORNP-UHFFFAOYSA-N |
| XLogP | -3.39 |
| TPSA | 249.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|