C13H22N4O5S — CID 18220022
5-amino-2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoic acid (PubChem CID 18220022) has the molecular formula C13H22N4O5S and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-amino-2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18220022 |
| Molecular Formula | C13H22N4O5S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 5-amino-2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C1CCCN1C(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C13H22N4O5S/c14-7(6-23)12(20)17-5-1-2-9(17)11(19)16-8(13(21)22)3-4-10(15)18/h7-9,23H,1-6,14H2,(H2,15,18)(H,16,19)(H,21,22) |
| InChIKey | TXCCRYAZQBUCOV-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|