C22H42N10O5S — CID 19999139
2-[[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19999139) has the molecular formula C22H42N10O5S and a molecular weight of 558.71 g/mol. Its IUPAC name is 2-[[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19999139 |
| Molecular Formula | C22H42N10O5S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 2-[[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CSCCC(N)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H42N10O5S/c1-38-12-8-13(23)19(35)32-11-4-7-16(32)18(34)30-14(5-2-9-28-21(24)25)17(33)31-15(20(36)37)6-3-10-29-22(26)27/h13-16H,2-12,23H2,1H3,(H,30,34)(H,31,33)(H,36,37)(H4,24,25,28)(H4,26,27,29) |
| InChIKey | ALHJQARVURXISM-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 270.63 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|