C21H37N7O5S — CID 19999152
1-[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 19999152) has the molecular formula C21H37N7O5S and a molecular weight of 499.64 g/mol. Its IUPAC name is 1-[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 19999152 |
| Molecular Formula | C21H37N7O5S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 1-[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CSCCC(N)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C21H37N7O5S/c1-34-12-8-13(22)18(30)27-10-3-6-15(27)17(29)26-14(5-2-9-25-21(23)24)19(31)28-11-4-7-16(28)20(32)33/h13-16H,2-12,22H2,1H3,(H,26,29)(H,32,33)(H4,23,24,25) |
| InChIKey | PQHYXZKMGYWTKG-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 197.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|