C19H35N7O5S — CID 19999138
2-[[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid (PubChem CID 19999138) has the molecular formula C19H35N7O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-[[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19999138 |
| Molecular Formula | C19H35N7O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 2-[[2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
| SMILES | CSCCC(N)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C19H35N7O5S/c1-11(18(30)31)24-15(27)13(5-3-8-23-19(21)22)25-16(28)14-6-4-9-26(14)17(29)12(20)7-10-32-2/h11-14H,3-10,20H2,1-2H3,(H,24,27)(H,25,28)(H,30,31)(H4,21,22,23) |
| InChIKey | LLTGJNIOUNSNRT-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|