C19H35N7O5 — CID 18246449
2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]propanoic acid (PubChem CID 18246449) has the molecular formula C19H35N7O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18246449 |
| Molecular Formula | C19H35N7O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(C)C)C(=O)O |
| InChI | InChI=1S/C19H35N7O5/c1-10(2)14(16(28)24-11(3)18(30)31)25-15(27)13-7-5-9-26(13)17(29)12(20)6-4-8-23-19(21)22/h10-14H,4-9,20H2,1-3H3,(H,24,28)(H,25,27)(H,30,31)(H4,21,22,23) |
| InChIKey | XVYQIQFGBSEYON-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|