C21H37N7O7 — CID 18246192
4-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-5-[(1-carboxy-2-methylpropyl)amino]-5-oxopentanoic acid (PubChem CID 18246192) has the molecular formula C21H37N7O7 and a molecular weight of 499.57 g/mol. Its IUPAC name is 4-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-5-[(1-carboxy-2-methylpropyl)amino]-5-oxopentanoic acid.
| Compound Name | 4-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-5-[(1-carboxy-2-methylpropyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18246192 |
| Molecular Formula | C21H37N7O7 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 4-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-5-[(1-carboxy-2-methylpropyl)amino]-5-oxopentanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H37N7O7/c1-11(2)16(20(34)35)27-17(31)13(7-8-15(29)30)26-18(32)14-6-4-10-28(14)19(33)12(22)5-3-9-25-21(23)24/h11-14,16H,3-10,22H2,1-2H3,(H,26,32)(H,27,31)(H,29,30)(H,34,35)(H4,23,24,25) |
| InChIKey | IFBFNSDLLCCGBP-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 243.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|