C22H42N10O5 — CID 18241211
2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 18241211) has the molecular formula C22H42N10O5 and a molecular weight of 526.64 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18241211 |
| Molecular Formula | C22H42N10O5 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H42N10O5/c1-12(2)16(20(36)37)31-18(34)15-8-5-11-32(15)19(35)14(7-4-10-29-22(26)27)30-17(33)13(23)6-3-9-28-21(24)25/h12-16H,3-11,23H2,1-2H3,(H,30,33)(H,31,34)(H,36,37)(H4,24,25,28)(H4,26,27,29) |
| InChIKey | SPAAHPKIZRHGLS-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 270.63 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|