C23H43N7O5 — CID 18244381
2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 18244381) has the molecular formula C23H43N7O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18244381 |
| Molecular Formula | C23H43N7O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C1CCCN1C(=O)C(NC(=O)C(N)CCCN=C(N)N)C(C)CC)C(=O)O |
| InChI | InChI=1S/C23H43N7O5/c1-5-13(3)17(28-19(31)15(24)9-7-11-27-23(25)26)21(33)30-12-8-10-16(30)20(32)29-18(22(34)35)14(4)6-2/h13-18H,5-12,24H2,1-4H3,(H,28,31)(H,29,32)(H,34,35)(H4,25,26,27) |
| InChIKey | UFMCONMIDWCANU-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|