C18H33N7O5 — CID 18246456
2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]acetic acid (PubChem CID 18246456) has the molecular formula C18H33N7O5 and a molecular weight of 427.51 g/mol. Its IUPAC name is 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18246456 |
| Molecular Formula | C18H33N7O5 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-[[2-[[1-[2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]acetic acid |
| SMILES | CC(C)C(NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C18H33N7O5/c1-10(2)14(16(29)23-9-13(26)27)24-15(28)12-6-4-8-25(12)17(30)11(19)5-3-7-22-18(20)21/h10-12,14H,3-9,19H2,1-2H3,(H,23,29)(H,24,28)(H,26,27)(H4,20,21,22) |
| InChIKey | TYPXZMQIVXYQAN-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|