C14H26N6O3 — CID 174419884
(2S)-1-(2-aminopropanoyl)-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 174419884) has the molecular formula C14H26N6O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2S)-1-(2-aminopropanoyl)-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-aminopropanoyl)-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 174419884 |
| Molecular Formula | C14H26N6O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (2S)-1-(2-aminopropanoyl)-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(N)C(=O)N1CCC[C@H]1C(=O)NC(C=O)CCCN=C(N)N |
| InChI | InChI=1S/C14H26N6O3/c1-9(15)13(23)20-7-3-5-11(20)12(22)19-10(8-21)4-2-6-18-14(16)17/h8-11H,2-7,15H2,1H3,(H,19,22)(H4,16,17,18)/t9?,10?,11-/m0/s1 |
| InChIKey | QTIXBUPIFFIWRW-ILDUYXDCSA-N |
| XLogP | -1.94 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|