C19H37N7O8S — CID 22846220
(2S)-1-[(2R)-6-acetamido-2-aminohexanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide;sulfuric acid (PubChem CID 22846220) has the molecular formula C19H37N7O8S and a molecular weight of 523.61 g/mol. Its IUPAC name is (2S)-1-[(2R)-6-acetamido-2-aminohexanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide;sulfuric acid.
| Compound Name | (2S)-1-[(2R)-6-acetamido-2-aminohexanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 22846220 |
| Molecular Formula | C19H37N7O8S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (2S)-1-[(2R)-6-acetamido-2-aminohexanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide;sulfuric acid |
| SMILES | CC(=O)NCCCC[C@@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C=O)CCCN=C(N)N.O=S(=O)(O)O |
| InChI | InChI=1S/C19H35N7O4.H2O4S/c1-13(28)23-9-3-2-7-15(20)18(30)26-11-5-8-16(26)17(29)25-14(12-27)6-4-10-24-19(21)22;1-5(2,3)4/h12,14-16H,2-11,20H2,1H3,(H,23,28)(H,25,29)(H4,21,22,24);(H2,1,2,3,4)/t14-,15+,16-;/m0./s1 |
| InChIKey | GJZNHIJCHNGUNF-CLUYDPBTSA-N |
| XLogP | -2.30 |
| TPSA | 260.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|