C16H29N5O4 — CID 123424315
(2S)-N-[(2S)-5-amino-1,5-dioxopentan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxamide (PubChem CID 123424315) has the molecular formula C16H29N5O4 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2S)-N-[(2S)-5-amino-1,5-dioxopentan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-5-amino-1,5-dioxopentan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123424315 |
| Molecular Formula | C16H29N5O4 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | (2S)-N-[(2S)-5-amino-1,5-dioxopentan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C=O)CCC(N)=O |
| InChI | InChI=1S/C16H29N5O4/c17-8-2-1-4-12(18)16(25)21-9-3-5-13(21)15(24)20-11(10-22)6-7-14(19)23/h10-13H,1-9,17-18H2,(H2,19,23)(H,20,24)/t11-,12-,13-/m0/s1 |
| InChIKey | LLJAKTFVNQSTES-AVGNSLFASA-N |
| XLogP | -1.62 |
| TPSA | 161.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|