C16H33Cl2N5O3 — CID 90472143
(2S)-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxamide;dihydrochloride (PubChem CID 90472143) has the molecular formula C16H33Cl2N5O3 and a molecular weight of 414.38 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxamide;dihydrochloride.
| Compound Name | (2S)-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 90472143 |
| Molecular Formula | C16H33Cl2N5O3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxamide;dihydrochloride |
| SMILES | CC(C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCCN)C(N)=O.Cl.Cl |
| InChI | InChI=1S/C16H31N5O3.2ClH/c1-10(2)13(14(19)22)20-15(23)12-7-5-9-21(12)16(24)11(18)6-3-4-8-17;;/h10-13H,3-9,17-18H2,1-2H3,(H2,19,22)(H,20,23);2*1H/t11-,12-,13-;;/m0../s1 |
| InChIKey | CESXAQVAHAURQV-DUXBUTLISA-N |
| XLogP | -0.10 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|