C19H35N5O6 — CID 18308241
2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18308241) has the molecular formula C19H35N5O6 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18308241 |
| Molecular Formula | C19H35N5O6 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(C)C(NC(=O)C1CCCN1C(=O)C(N)CCCCN)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C19H35N5O6/c1-11(2)15(17(27)22-13(10-25)19(29)30)23-16(26)14-7-5-9-24(14)18(28)12(21)6-3-4-8-20/h11-15,25H,3-10,20-21H2,1-2H3,(H,22,27)(H,23,26)(H,29,30) |
| InChIKey | KVMQKFSQRJNZKK-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|