C22H42N6O5 — CID 18310131
6-amino-2-[[1-[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 18310131) has the molecular formula C22H42N6O5 and a molecular weight of 470.62 g/mol. Its IUPAC name is 6-amino-2-[[1-[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[1-[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18310131 |
| Molecular Formula | C22H42N6O5 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 6-amino-2-[[1-[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCCN)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C22H42N6O5/c1-14(2)18(27-19(29)15(25)8-3-5-11-23)21(31)28-13-7-10-17(28)20(30)26-16(22(32)33)9-4-6-12-24/h14-18H,3-13,23-25H2,1-2H3,(H,26,30)(H,27,29)(H,32,33) |
| InChIKey | XHMGGOHMWXWXHS-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 193.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|