C17H32N4O4 — CID 18222230
6-amino-2-[[1-(2-amino-4-methylpentanoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 18222230) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is 6-amino-2-[[1-(2-amino-4-methylpentanoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[1-(2-amino-4-methylpentanoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18222230 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 6-amino-2-[[1-(2-amino-4-methylpentanoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | CC(C)CC(N)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C17H32N4O4/c1-11(2)10-12(19)16(23)21-9-5-7-14(21)15(22)20-13(17(24)25)6-3-4-8-18/h11-14H,3-10,18-19H2,1-2H3,(H,20,22)(H,24,25) |
| InChIKey | YRRCOJOXAJNSAX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|