(2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid

C11H21N3O3 — CID 67280679

IUPAC(2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid
SMILESNCCCCC(N)C(=O)N1CCC[C@@H]1C(=O)O
InChIInChI=1S/C11H21N3O3/c12-6-2-1-4-8(13)10(15)14-7-3-5-9(14)11(16)17/h8-9H,1-7,12-13H2,(H,16,17)/t8?,9-/m1/s1
InChIKeyAIXUQKMMBQJZCU-YGPZHTELSA-N
MW243.31 g/mol
LogP-0.48
Rot. Bonds6

About (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid

(2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 67280679) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name(2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid
PubChem CID67280679
Molecular FormulaC11H21N3O3
Molecular Weight243.31 g/mol
Exact Mass243.16
IUPAC Name(2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid
SMILESNCCCCC(N)C(=O)N1CCC[C@@H]1C(=O)O
InChIInChI=1S/C11H21N3O3/c12-6-2-1-4-8(13)10(15)14-7-3-5-9(14)11(16)17/h8-9H,1-7,12-13H2,(H,16,17)/t8?,9-/m1/s1
InChIKeyAIXUQKMMBQJZCU-YGPZHTELSA-N
XLogP-0.48
TPSA109.65 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.31
LogP ≤ 5-0.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid (CID 67280679) is (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid is NCCCCC(N)C(=O)N1CCC[C@@H]1C(=O)O.
What is the InChIKey of (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid?
The InChIKey is AIXUQKMMBQJZCU-YGPZHTELSA-N. The full InChI is InChI=1S/C11H21N3O3/c12-6-2-1-4-8(13)10(15)14-7-3-5-9(14)11(16)17/h8-9H,1-7,12-13H2,(H,16,17)/t8?,9-/m1/s1.
What are the key properties of (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid?
(2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid has a molecular weight of 243.31 g/mol, XLogP of -0.48, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 67280679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).