C11H21N3O3 — CID 67280679
(2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 67280679) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67280679 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (2R)-1-(2,6-diaminohexanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(N)C(=O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H21N3O3/c12-6-2-1-4-8(13)10(15)14-7-3-5-9(14)11(16)17/h8-9H,1-7,12-13H2,(H,16,17)/t8?,9-/m1/s1 |
| InChIKey | AIXUQKMMBQJZCU-YGPZHTELSA-N |
| XLogP | -0.48 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|