C20H33N5O9 — CID 18303615
1-[4-carboxy-2-[[3-carboxy-2-(2,6-diaminohexanoylamino)propanoyl]amino]butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18303615) has the molecular formula C20H33N5O9 and a molecular weight of 487.51 g/mol. Its IUPAC name is 1-[4-carboxy-2-[[3-carboxy-2-(2,6-diaminohexanoylamino)propanoyl]amino]butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[4-carboxy-2-[[3-carboxy-2-(2,6-diaminohexanoylamino)propanoyl]amino]butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18303615 |
| Molecular Formula | C20H33N5O9 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-[4-carboxy-2-[[3-carboxy-2-(2,6-diaminohexanoylamino)propanoyl]amino]butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(N)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C20H33N5O9/c21-8-2-1-4-11(22)17(30)24-13(10-16(28)29)18(31)23-12(6-7-15(26)27)19(32)25-9-3-5-14(25)20(33)34/h11-14H,1-10,21-22H2,(H,23,31)(H,24,30)(H,26,27)(H,28,29)(H,33,34) |
| InChIKey | OUQUUSYZWLACHI-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 242.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|