C21H35N5O9 — CID 22697105
1-[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 22697105) has the molecular formula C21H35N5O9 and a molecular weight of 501.54 g/mol. Its IUPAC name is 1-[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22697105 |
| Molecular Formula | C21H35N5O9 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C21H35N5O9/c22-10-2-1-4-13(24-18(31)12(23)6-8-16(27)28)19(32)25-14(7-9-17(29)30)20(33)26-11-3-5-15(26)21(34)35/h12-15H,1-11,22-23H2,(H,24,31)(H,25,32)(H,27,28)(H,29,30)(H,34,35) |
| InChIKey | MQRUPQFNAGFPTR-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 242.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|