C21H36N6O8 — CID 18304972
2-[[1-[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 18304972) has the molecular formula C21H36N6O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[[1-[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[1-[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18304972 |
| Molecular Formula | C21H36N6O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 2-[[1-[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(N)=O)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H36N6O8/c22-10-2-1-4-12(23)18(31)25-13(6-8-16(24)28)20(33)27-11-3-5-15(27)19(32)26-14(21(34)35)7-9-17(29)30/h12-15H,1-11,22-23H2,(H2,24,28)(H,25,31)(H,26,32)(H,29,30)(H,34,35) |
| InChIKey | ADZBRHBQDOOWQL-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 248.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|