C27H41N7O9S2 — CID 22846214
(2S)-1-[(2R)-2-amino-6-(naphthalen-2-ylsulfonylamino)hexanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide;sulfuric acid (PubChem CID 22846214) has the molecular formula C27H41N7O9S2 and a molecular weight of 671.80 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-amino-6-(naphthalen-2-ylsulfonylamino)hexanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide;sulfuric acid.
| Compound Name | (2S)-1-[(2R)-2-amino-6-(naphthalen-2-ylsulfonylamino)hexanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 22846214 |
| Molecular Formula | C27H41N7O9S2 |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.24 |
| IUPAC Name | (2S)-1-[(2R)-2-amino-6-(naphthalen-2-ylsulfonylamino)hexanoyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide;sulfuric acid |
| SMILES | NC(N)=NCCC[C@@H](C=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](N)CCCCNS(=O)(=O)c1ccc2ccccc2c1.O=S(=O)(O)O |
| InChI | InChI=1S/C27H39N7O5S.H2O4S/c28-23(10-3-4-15-32-40(38,39)22-13-12-19-7-1-2-8-20(19)17-22)26(37)34-16-6-11-24(34)25(36)33-21(18-35)9-5-14-31-27(29)30;1-5(2,3)4/h1-2,7-8,12-13,17-18,21,23-24,32H,3-6,9-11,14-16,28H2,(H,33,36)(H4,29,30,31);(H2,1,2,3,4)/t21-,23+,24-;/m0./s1 |
| InChIKey | HOGXMEKALNAXIZ-IRZUIDNJSA-N |
| XLogP | -0.31 |
| TPSA | 277.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|