C25H35N7O5S — CID 18658380
(2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetyl]pyrrolidine-2-carboxamide (PubChem CID 18658380) has the molecular formula C25H35N7O5S and a molecular weight of 545.67 g/mol. Its IUPAC name is (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18658380 |
| Molecular Formula | C25H35N7O5S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (2S)-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]acetyl]pyrrolidine-2-carboxamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCC(=O)N3CCC[C@H]3C(=O)N[C@H](C=O)CCCN=C(N)N)cccc12 |
| InChI | InChI=1S/C25H35N7O5S/c1-31(2)20-10-3-9-19-18(20)8-4-12-22(19)38(36,37)29-15-23(34)32-14-6-11-21(32)24(35)30-17(16-33)7-5-13-28-25(26)27/h3-4,8-10,12,16-17,21,29H,5-7,11,13-15H2,1-2H3,(H,30,35)(H4,26,27,28)/t17-,21-/m0/s1 |
| InChIKey | RNPZAARZHFUBFA-UWJYYQICSA-N |
| XLogP | -0.09 |
| TPSA | 180.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|