C20H30N6O6S — CID 18378030
5-(diaminomethylideneamino)-2-[[1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid (PubChem CID 18378030) has the molecular formula C20H30N6O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 18378030 |
| Molecular Formula | C20H30N6O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(=O)O)cc1 |
| InChI | InChI=1S/C20H30N6O6S/c1-13-6-8-14(9-7-13)33(31,32)24-12-17(27)26-11-3-5-16(26)18(28)25-15(19(29)30)4-2-10-23-20(21)22/h6-9,15-16,24H,2-5,10-12H2,1H3,(H,25,28)(H,29,30)(H4,21,22,23) |
| InChIKey | YSRMCZDHEZNRPS-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 197.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|