C26H35N6O6S+ — CID 173236154
(N-[(2S)-6-amino-2-[[(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]hexanoyl]anilino)-oxoazanium (PubChem CID 173236154) has the molecular formula C26H35N6O6S+ and a molecular weight of 559.67 g/mol. Its IUPAC name is (N-[(2S)-6-amino-2-[[(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]hexanoyl]anilino)-oxoazanium.
| Compound Name | (N-[(2S)-6-amino-2-[[(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]hexanoyl]anilino)-oxoazanium |
|---|---|
| PubChem CID | 173236154 |
| Molecular Formula | C26H35N6O6S+ |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | (N-[(2S)-6-amino-2-[[(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]hexanoyl]anilino)-oxoazanium |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCCN)C(=O)N([NH+]=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H34N6O6S/c1-19-12-14-21(15-13-19)39(37,38)28-18-24(33)31-17-7-11-23(31)25(34)29-22(10-5-6-16-27)26(35)32(30-36)20-8-3-2-4-9-20/h2-4,8-9,12-15,22-23,28H,5-7,10-11,16-18,27H2,1H3,(H,29,34)/p+1/t22-,23-/m0/s1 |
| InChIKey | HSZVPWSXUQXVBM-GOTSBHOMSA-O |
| XLogP | -0.33 |
| TPSA | 172.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|