C23H30N4O3 — CID 146257278
(2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carboxamide (PubChem CID 146257278) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146257278 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (2S)-N-[(2S)-1,6-diamino-1-oxohexan-2-yl]-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)Cc1cccc2ccccc12)C(N)=O |
| InChI | InChI=1S/C23H30N4O3/c24-13-4-3-11-19(22(25)29)26-23(30)20-12-6-14-27(20)21(28)15-17-9-5-8-16-7-1-2-10-18(16)17/h1-2,5,7-10,19-20H,3-4,6,11-15,24H2,(H2,25,29)(H,26,30)/t19-,20-/m0/s1 |
| InChIKey | IAAKPYYXZFIUKN-PMACEKPBSA-N |
| XLogP | 1.47 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|