C25H39N9O6 — CID 146257264
N-[6-amino-1-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(4-nitrophenyl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 146257264) has the molecular formula C25H39N9O6 and a molecular weight of 561.64 g/mol. Its IUPAC name is N-[6-amino-1-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(4-nitrophenyl)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[6-amino-1-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(4-nitrophenyl)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146257264 |
| Molecular Formula | C25H39N9O6 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | N-[6-amino-1-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(4-nitrophenyl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | NCCCCC(NC(=O)C1CCCN1C(=O)Cc1ccc([N+](=O)[O-])cc1)C(=O)NC(CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C25H39N9O6/c26-12-2-1-5-19(23(37)31-18(22(27)36)6-3-13-30-25(28)29)32-24(38)20-7-4-14-33(20)21(35)15-16-8-10-17(11-9-16)34(39)40/h8-11,18-20H,1-7,12-15,26H2,(H2,27,36)(H,31,37)(H,32,38)(H4,28,29,30) |
| InChIKey | RFAYYMDMXXKVHT-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 255.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|