C31H45N7O5 — CID 175943507
(2S)-2-[[(2S)-2-[[(2R)-1-(6-aminohexanoyl)pyrrolidine-2-carbonyl]amino]-6-(diaminomethylideneamino)hexanoyl]amino]-3-naphthalen-1-ylpropanoic acid (PubChem CID 175943507) has the molecular formula C31H45N7O5 and a molecular weight of 595.75 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2R)-1-(6-aminohexanoyl)pyrrolidine-2-carbonyl]amino]-6-(diaminomethylideneamino)hexanoyl]amino]-3-naphthalen-1-ylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2R)-1-(6-aminohexanoyl)pyrrolidine-2-carbonyl]amino]-6-(diaminomethylideneamino)hexanoyl]amino]-3-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 175943507 |
| Molecular Formula | C31H45N7O5 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2R)-1-(6-aminohexanoyl)pyrrolidine-2-carbonyl]amino]-6-(diaminomethylideneamino)hexanoyl]amino]-3-naphthalen-1-ylpropanoic acid |
| SMILES | NCCCCCC(=O)N1CCC[C@@H]1C(=O)N[C@@H](CCCCN=C(N)N)C(=O)N[C@@H](Cc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C31H45N7O5/c32-17-6-1-2-16-27(39)38-19-9-15-26(38)29(41)36-24(14-5-7-18-35-31(33)34)28(40)37-25(30(42)43)20-22-12-8-11-21-10-3-4-13-23(21)22/h3-4,8,10-13,24-26H,1-2,5-7,9,14-20,32H2,(H,36,41)(H,37,40)(H,42,43)(H4,33,34,35)/t24-,25-,26+/m0/s1 |
| InChIKey | TWXHKBMWDIVYHY-KKUQBAQOSA-N |
| XLogP | 1.39 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|