C28H37N5O6 — CID 146257285
5-amino-4-[[6-amino-2-[[(2S)-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-5-oxopentanoic acid (PubChem CID 146257285) has the molecular formula C28H37N5O6 and a molecular weight of 539.63 g/mol. Its IUPAC name is 5-amino-4-[[6-amino-2-[[(2S)-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-4-[[6-amino-2-[[(2S)-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 146257285 |
| Molecular Formula | C28H37N5O6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 5-amino-4-[[6-amino-2-[[(2S)-1-(2-naphthalen-1-ylacetyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(NC(=O)[C@@H]1CCCN1C(=O)Cc1cccc2ccccc12)C(=O)NC(CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C28H37N5O6/c29-15-4-3-11-22(27(38)31-21(26(30)37)13-14-25(35)36)32-28(39)23-12-6-16-33(23)24(34)17-19-9-5-8-18-7-1-2-10-20(18)19/h1-2,5,7-10,21-23H,3-4,6,11-17,29H2,(H2,30,37)(H,31,38)(H,32,39)(H,35,36)/t21?,22?,23-/m0/s1 |
| InChIKey | FWYFNEHNSQFPHN-VNXZQDSDSA-N |
| XLogP | 0.82 |
| TPSA | 184.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|