C28H43N7O8 — CID 170174561
6-amino-2-[[2-[[6-amino-2-[[1-(pyridine-3-carbonyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 170174561) has the molecular formula C28H43N7O8 and a molecular weight of 605.69 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[[1-(pyridine-3-carbonyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[[1-(pyridine-3-carbonyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 170174561 |
| Molecular Formula | C28H43N7O8 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[[1-(pyridine-3-carbonyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C1CCCN1C(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C28H43N7O8/c29-13-3-1-8-19(33-26(40)22-10-6-16-35(22)27(41)18-7-5-15-31-17-18)24(38)32-20(11-12-23(36)37)25(39)34-21(28(42)43)9-2-4-14-30/h5,7,15,17,19-22H,1-4,6,8-14,16,29-30H2,(H,32,38)(H,33,40)(H,34,39)(H,36,37)(H,42,43) |
| InChIKey | GCBNCGVLSAZODW-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 247.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|