C18H26N4O4 — CID 129026510
6-amino-2-[[(2S)-1-(4-aminobenzoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 129026510) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 6-amino-2-[[(2S)-1-(4-aminobenzoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[(2S)-1-(4-aminobenzoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 129026510 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 6-amino-2-[[(2S)-1-(4-aminobenzoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)[C@@H]1CCCN1C(=O)c1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C18H26N4O4/c19-10-2-1-4-14(18(25)26)21-16(23)15-5-3-11-22(15)17(24)12-6-8-13(20)9-7-12/h6-9,14-15H,1-5,10-11,19-20H2,(H,21,23)(H,25,26)/t14?,15-/m0/s1 |
| InChIKey | GKHXZBKFONVTIX-LOACHALJSA-N |
| XLogP | 0.57 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|