C19H36N6O5 — CID 18489354
6-amino-2-[[1-[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 18489354) has the molecular formula C19H36N6O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is 6-amino-2-[[1-[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[1-[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18489354 |
| Molecular Formula | C19H36N6O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 6-amino-2-[[1-[6-amino-2-[(2-aminoacetyl)amino]hexanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)CN)C(=O)O |
| InChI | InChI=1S/C19H36N6O5/c20-9-3-1-6-13(23-16(26)12-22)18(28)25-11-5-8-15(25)17(27)24-14(19(29)30)7-2-4-10-21/h13-15H,1-12,20-22H2,(H,23,26)(H,24,27)(H,29,30) |
| InChIKey | WSZWGCGYIPDGBB-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 193.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|