C19H33N5O8 — CID 18750909
2-[[6-amino-2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 18750909) has the molecular formula C19H33N5O8 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-[[6-amino-2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18750909 |
| Molecular Formula | C19H33N5O8 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-[[6-amino-2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(N)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H33N5O8/c1-10(25)15(21)18(30)24-8-4-6-13(24)17(29)22-11(5-2-3-7-20)16(28)23-12(19(31)32)9-14(26)27/h10-13,15,25H,2-9,20-21H2,1H3,(H,22,29)(H,23,28)(H,26,27)(H,31,32) |
| InChIKey | HNIXDICPOHYVGO-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 225.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|