C18H33N5O6 — CID 18750698
6-amino-2-[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]hexanoic acid (PubChem CID 18750698) has the molecular formula C18H33N5O6 and a molecular weight of 415.49 g/mol. Its IUPAC name is 6-amino-2-[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18750698 |
| Molecular Formula | C18H33N5O6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 6-amino-2-[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)C1CCCN1C(=O)C(N)C(C)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C18H33N5O6/c1-10(15(25)22-12(18(28)29)6-3-4-8-19)21-16(26)13-7-5-9-23(13)17(27)14(20)11(2)24/h10-14,24H,3-9,19-20H2,1-2H3,(H,21,26)(H,22,25)(H,28,29) |
| InChIKey | XMPMJBJZWFDHQI-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|