C22H40N8O7 — CID 22698209
6-amino-2-[[2-[[1-(2-amino-4-carboxybutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 22698209) has the molecular formula C22H40N8O7 and a molecular weight of 528.61 g/mol. Its IUPAC name is 6-amino-2-[[2-[[1-(2-amino-4-carboxybutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[1-(2-amino-4-carboxybutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22698209 |
| Molecular Formula | C22H40N8O7 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 6-amino-2-[[2-[[1-(2-amino-4-carboxybutanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H40N8O7/c23-10-2-1-5-15(21(36)37)29-18(33)14(6-3-11-27-22(25)26)28-19(34)16-7-4-12-30(16)20(35)13(24)8-9-17(31)32/h13-16H,1-12,23-24H2,(H,28,34)(H,29,33)(H,31,32)(H,36,37)(H4,25,26,27) |
| InChIKey | BRHFJUQRLNHACU-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 269.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|