C23H44N8O5 — CID 18308048
2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18308048) has the molecular formula C23H44N8O5 and a molecular weight of 512.66 g/mol. Its IUPAC name is 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18308048 |
| Molecular Formula | C23H44N8O5 |
| Molecular Weight | 512.66 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)CC(NC(=O)C1CCCN1C(=O)C(N)CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H44N8O5/c1-14(2)13-17(19(32)29-16(22(35)36)8-5-11-28-23(26)27)30-20(33)18-9-6-12-31(18)21(34)15(25)7-3-4-10-24/h14-18H,3-13,24-25H2,1-2H3,(H,29,32)(H,30,33)(H,35,36)(H4,26,27,28) |
| InChIKey | NBIQAFNEUYHYKJ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 232.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.66 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|