C20H38N8O5S — CID 18242398
6-amino-2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 18242398) has the molecular formula C20H38N8O5S and a molecular weight of 502.64 g/mol. Its IUPAC name is 6-amino-2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18242398 |
| Molecular Formula | C20H38N8O5S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 6-amino-2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-sulfanylpropanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C1CCCN1C(=O)C(CS)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H38N8O5S/c21-8-2-1-6-13(19(32)33)26-17(30)15-7-4-10-28(15)18(31)14(11-34)27-16(29)12(22)5-3-9-25-20(23)24/h12-15,34H,1-11,21-22H2,(H,26,30)(H,27,29)(H,32,33)(H4,23,24,25) |
| InChIKey | JRKQRSFEWLVDES-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 232.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|