C26H40N8O6 — CID 146257226
(2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(1,3-benzodioxol-5-yl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 146257226) has the molecular formula C26H40N8O6 and a molecular weight of 560.66 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(1,3-benzodioxol-5-yl)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(1,3-benzodioxol-5-yl)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146257226 |
| Molecular Formula | C26H40N8O6 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (2S)-N-[(2S)-6-amino-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]-1-[2-(1,3-benzodioxol-5-yl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)Cc1ccc2c(c1)OCO2)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C26H40N8O6/c27-10-2-1-5-18(24(37)32-17(23(28)36)6-3-11-31-26(29)30)33-25(38)19-7-4-12-34(19)22(35)14-16-8-9-20-21(13-16)40-15-39-20/h8-9,13,17-19H,1-7,10-12,14-15,27H2,(H2,28,36)(H,32,37)(H,33,38)(H4,29,30,31)/t17-,18-,19-/m0/s1 |
| InChIKey | FHCOURVJGPZRSR-FHWLQOOXSA-N |
| XLogP | -1.41 |
| TPSA | 230.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|