C23H31N5O5 — CID 87694577
(2S)-1-(2-aminoacetyl)-N-[(2S)-6-amino-1-oxo-1-[(2-oxochromen-3-yl)methylamino]hexan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 87694577) has the molecular formula C23H31N5O5 and a molecular weight of 457.53 g/mol. Its IUPAC name is (2S)-1-(2-aminoacetyl)-N-[(2S)-6-amino-1-oxo-1-[(2-oxochromen-3-yl)methylamino]hexan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-aminoacetyl)-N-[(2S)-6-amino-1-oxo-1-[(2-oxochromen-3-yl)methylamino]hexan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87694577 |
| Molecular Formula | C23H31N5O5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (2S)-1-(2-aminoacetyl)-N-[(2S)-6-amino-1-oxo-1-[(2-oxochromen-3-yl)methylamino]hexan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CN)C(=O)NCc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H31N5O5/c24-10-4-3-7-17(27-22(31)18-8-5-11-28(18)20(29)13-25)21(30)26-14-16-12-15-6-1-2-9-19(15)33-23(16)32/h1-2,6,9,12,17-18H,3-5,7-8,10-11,13-14,24-25H2,(H,26,30)(H,27,31)/t17-,18-/m0/s1 |
| InChIKey | OKMVHABGEBMVCG-ROUUACIJSA-N |
| XLogP | -0.03 |
| TPSA | 160.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|