C28H47N5O8S — CID 88608100
butyl N-[(2S)-6-amino-1-[(2S)-2-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate;4-methylbenzenesulfonic acid (PubChem CID 88608100) has the molecular formula C28H47N5O8S and a molecular weight of 613.78 g/mol. Its IUPAC name is butyl N-[(2S)-6-amino-1-[(2S)-2-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate;4-methylbenzenesulfonic acid.
| Compound Name | butyl N-[(2S)-6-amino-1-[(2S)-2-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88608100 |
| Molecular Formula | C28H47N5O8S |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.31 |
| IUPAC Name | butyl N-[(2S)-6-amino-1-[(2S)-2-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxohexan-2-yl]carbamate;4-methylbenzenesulfonic acid |
| SMILES | CCCCOC(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(N)=O)C(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H39N5O5.C7H8O3S/c1-4-5-13-31-21(30)24-15(9-6-7-11-22)20(29)26-12-8-10-16(26)19(28)25-17(14(2)3)18(23)27;1-6-2-4-7(5-3-6)11(8,9)10/h14-17H,4-13,22H2,1-3H3,(H2,23,27)(H,24,30)(H,25,28);2-5H,1H3,(H,8,9,10)/t15-,16-,17-;/m0./s1 |
| InChIKey | ZETTZZFBVNPOCA-FRKSIBALSA-N |
| XLogP | 1.87 |
| TPSA | 211.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|