C26H36ClN7O7S — CID 175344985
4-amino-2-chlorophenol;5-(diaminomethylideneamino)-2-[[(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid (PubChem CID 175344985) has the molecular formula C26H36ClN7O7S and a molecular weight of 626.14 g/mol. Its IUPAC name is 4-amino-2-chlorophenol;5-(diaminomethylideneamino)-2-[[(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid.
| Compound Name | 4-amino-2-chlorophenol;5-(diaminomethylideneamino)-2-[[(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 175344985 |
| Molecular Formula | C26H36ClN7O7S |
| Molecular Weight | 626.14 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | 4-amino-2-chlorophenol;5-(diaminomethylideneamino)-2-[[(2S)-1-[2-[(4-methylphenyl)sulfonylamino]acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)N2CCC[C@H]2C(=O)NC(CCCN=C(N)N)C(=O)O)cc1.Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C20H30N6O6S.C6H6ClNO/c1-13-6-8-14(9-7-13)33(31,32)24-12-17(27)26-11-3-5-16(26)18(28)25-15(19(29)30)4-2-10-23-20(21)22;7-5-3-4(8)1-2-6(5)9/h6-9,15-16,24H,2-5,10-12H2,1H3,(H,25,28)(H,29,30)(H4,21,22,23);1-3,9H,8H2/t15?,16-;/m0./s1 |
| InChIKey | PIAVIAOWSYJKLZ-UFUZRDLVSA-N |
| XLogP | 0.52 |
| TPSA | 243.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|