C22H35N7O7 — CID 175418530
5-(diaminomethylideneamino)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid;4-nitroaniline (PubChem CID 175418530) has the molecular formula C22H35N7O7 and a molecular weight of 509.56 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid;4-nitroaniline.
| Compound Name | 5-(diaminomethylideneamino)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid;4-nitroaniline |
|---|---|
| PubChem CID | 175418530 |
| Molecular Formula | C22H35N7O7 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]pentanoic acid;4-nitroaniline |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NC(CCCN=C(N)N)C(=O)O.Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H29N5O5.C6H6N2O2/c1-16(2,3)26-15(25)21-9-5-7-11(21)12(22)20-10(13(23)24)6-4-8-19-14(17)18;7-5-1-3-6(4-2-5)8(9)10/h10-11H,4-9H2,1-3H3,(H,20,22)(H,23,24)(H4,17,18,19);1-4H,7H2/t10?,11-;/m0./s1 |
| InChIKey | GOTXNAPPZWPZKM-GQNCZFCYSA-N |
| XLogP | 1.19 |
| TPSA | 229.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|