C24H35N3O7 — CID 11754780
tert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 11754780) has the molecular formula C24H35N3O7 and a molecular weight of 477.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11754780 |
| Molecular Formula | C24H35N3O7 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)[C@@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35N3O7/c1-23(2,3)33-21(29)18(15-16-10-12-17(13-11-16)27(31)32)25-20(28)19-9-7-8-14-26(19)22(30)34-24(4,5)6/h10-13,18-19H,7-9,14-15H2,1-6H3,(H,25,28)/t18-,19-/m0/s1 |
| InChIKey | HMQKIYXEFRBLNY-OALUTQOASA-N |
| XLogP | 3.75 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|