C21H28N2O6 — CID 10046806
tert-butyl (2S)-2-[[(2S)-1-(2-methoxy-2-oxoacetyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoate (PubChem CID 10046806) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-1-(2-methoxy-2-oxoacetyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-1-(2-methoxy-2-oxoacetyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10046806 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-1-(2-methoxy-2-oxoacetyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H28N2O6/c1-21(2,3)29-19(26)15(13-14-9-6-5-7-10-14)22-17(24)16-11-8-12-23(16)18(25)20(27)28-4/h5-7,9-10,15-16H,8,11-13H2,1-4H3,(H,22,24)/t15-,16-/m0/s1 |
| InChIKey | UNKLGJHRZBZBGP-HOTGVXAUSA-N |
| XLogP | 1.22 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|