C19H25N2O4Se — CID 53495893
CID 53495893 (PubChem CID 53495893) has the molecular formula C19H25N2O4Se and a molecular weight of 424.38 g/mol.
| Compound Name | CID 53495893 |
|---|---|
| PubChem CID | 53495893 |
| Molecular Formula | C19H25N2O4Se |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)C[Se] |
| InChI | InChI=1S/C19H25N2O4Se/c1-13(12-26)18(23)21-10-6-9-16(21)17(22)20-15(19(24)25-2)11-14-7-4-3-5-8-14/h3-5,7-8,13,15-16H,6,9-12H2,1-2H3,(H,20,22)/t13-,15+,16+/m1/s1 |
| InChIKey | ABFXLYJBVUDXET-KBMXLJTQSA-N |
| XLogP | 1.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|