C21H29N3O6S2 — CID 54461429
(2S)-2-[[(2S)-1-[3-[(2-amino-2-carboxyethyl)disulfanyl]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 54461429) has the molecular formula C21H29N3O6S2 and a molecular weight of 483.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[3-[(2-amino-2-carboxyethyl)disulfanyl]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-[3-[(2-amino-2-carboxyethyl)disulfanyl]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 54461429 |
| Molecular Formula | C21H29N3O6S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | (2S)-2-[[(2S)-1-[3-[(2-amino-2-carboxyethyl)disulfanyl]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(CSSCC(N)C(=O)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H29N3O6S2/c1-13(11-31-32-12-15(22)20(27)28)19(26)24-9-5-8-17(24)18(25)23-16(21(29)30)10-14-6-3-2-4-7-14/h2-4,6-7,13,15-17H,5,8-12,22H2,1H3,(H,23,25)(H,27,28)(H,29,30)/t13?,15?,16-,17-/m0/s1 |
| InChIKey | XBWPYGJIVBXAIX-KMZOKZLKSA-N |
| XLogP | 1.22 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|