C23H32N4O7 — CID 57040603
(4-nitrophenyl)methyl 2-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 57040603) has the molecular formula C23H32N4O7 and a molecular weight of 476.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 57040603 |
| Molecular Formula | C23H32N4O7 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](NC(=O)C2CCCCN2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C23H32N4O7/c1-23(2,3)34-21(29)25-13-11-17(14-25)24-20(28)19-6-4-5-12-26(19)22(30)33-15-16-7-9-18(10-8-16)27(31)32/h7-10,17,19H,4-6,11-15H2,1-3H3,(H,24,28)/t17-,19?/m0/s1 |
| InChIKey | HZCVGZVHDVXADB-KKFHFHRHSA-N |
| XLogP | 3.21 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|