C23H40N2O3 — CID 139459619
tert-butyl (3R)-3-[(4-cycloheptylcyclohexanecarbonyl)amino]pyrrolidine-1-carboxylate (PubChem CID 139459619) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-cycloheptylcyclohexanecarbonyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(4-cycloheptylcyclohexanecarbonyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139459619 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | tert-butyl (3R)-3-[(4-cycloheptylcyclohexanecarbonyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](NC(=O)C2CCC(C3CCCCCC3)CC2)C1 |
| InChI | InChI=1S/C23H40N2O3/c1-23(2,3)28-22(27)25-15-14-20(16-25)24-21(26)19-12-10-18(11-13-19)17-8-6-4-5-7-9-17/h17-20H,4-16H2,1-3H3,(H,24,26)/t18?,19?,20-/m1/s1 |
| InChIKey | CKUWHHGCQVJBTE-SOAGJPPSSA-N |
| XLogP | 4.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |