C26H46N2O3 — CID 166956086
tert-butyl (3R)-3-[[2-(4-cyclononylcyclohexyl)acetyl]amino]pyrrolidine-1-carboxylate (PubChem CID 166956086) has the molecular formula C26H46N2O3 and a molecular weight of 434.67 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-(4-cyclononylcyclohexyl)acetyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-(4-cyclononylcyclohexyl)acetyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166956086 |
| Molecular Formula | C26H46N2O3 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | tert-butyl (3R)-3-[[2-(4-cyclononylcyclohexyl)acetyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](NC(=O)CC2CCC(C3CCCCCCCC3)CC2)C1 |
| InChI | InChI=1S/C26H46N2O3/c1-26(2,3)31-25(30)28-17-16-23(19-28)27-24(29)18-20-12-14-22(15-13-20)21-10-8-6-4-5-7-9-11-21/h20-23H,4-19H2,1-3H3,(H,27,29)/t20?,22?,23-/m1/s1 |
| InChIKey | QXONDXZMVVNGBX-IQWMQGJTSA-N |
| XLogP | 6.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |